C8H14O6 — CID 142408059
1-(3,4,5,6-tetrahydroxyoxan-2-yl)propan-2-one (PubChem CID 142408059) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrahydroxyoxan-2-yl)propan-2-one.
| Compound Name | 1-(3,4,5,6-tetrahydroxyoxan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 142408059 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-(3,4,5,6-tetrahydroxyoxan-2-yl)propan-2-one |
| SMILES | CC(=O)CC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C8H14O6/c1-3(9)2-4-5(10)6(11)7(12)8(13)14-4/h4-8,10-13H,2H2,1H3 |
| InChIKey | FXKIAXAZSBBALO-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |