C11H20N2O6 — CID 89197685
[6-[(2E)-2-(ethylhydrazinylidene)propyl]-3,4,5-trihydroxyoxan-2-yl] formate (PubChem CID 89197685) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is [6-[(2E)-2-(ethylhydrazinylidene)propyl]-3,4,5-trihydroxyoxan-2-yl] formate.
| Compound Name | [6-[(2E)-2-(ethylhydrazinylidene)propyl]-3,4,5-trihydroxyoxan-2-yl] formate |
|---|---|
| PubChem CID | 89197685 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [6-[(2E)-2-(ethylhydrazinylidene)propyl]-3,4,5-trihydroxyoxan-2-yl] formate |
| SMILES | CCN/N=C(\C)CC1OC(OC=O)C(O)C(O)C1O |
| InChI | InChI=1S/C11H20N2O6/c1-3-12-13-6(2)4-7-8(15)9(16)10(17)11(19-7)18-5-14/h5,7-12,15-17H,3-4H2,1-2H3/b13-6+ |
| InChIKey | WMFUYWVCNCJMCT-AWNIVKPZSA-N |
| XLogP | -1.66 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|