C14H26N4O11 — CID 130183683
2-[(3S,6R)-6-[(2R,5S)-6-(2-hydrazinyl-2-oxoethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]acetohydrazide (PubChem CID 130183683) has the molecular formula C14H26N4O11 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[(3S,6R)-6-[(2R,5S)-6-(2-hydrazinyl-2-oxoethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]acetohydrazide.
| Compound Name | 2-[(3S,6R)-6-[(2R,5S)-6-(2-hydrazinyl-2-oxoethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 130183683 |
| Molecular Formula | C14H26N4O11 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[(3S,6R)-6-[(2R,5S)-6-(2-hydrazinyl-2-oxoethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]acetohydrazide |
| SMILES | NNC(=O)CC1O[C@H](O[C@H]2OC(CC(=O)NN)[C@@H](O)C(O)C2O)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H26N4O11/c15-17-5(19)1-3-7(21)9(23)11(25)13(27-3)29-14-12(26)10(24)8(22)4(28-14)2-6(20)18-16/h3-4,7-14,21-26H,1-2,15-16H2,(H,17,19)(H,18,20)/t3?,4?,7-,8-,9?,10?,11?,12?,13-,14-/m1/s1 |
| InChIKey | FONNNGLQVABUAG-RBRVEBJUSA-N |
| XLogP | -6.62 |
| TPSA | 259.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|