C10H22O6S4 — CID 87519711
2-methyl-4-[(3-methyl-3-sulfobutyl)disulfanyl]butane-2-sulfonic acid (PubChem CID 87519711) has the molecular formula C10H22O6S4 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-methyl-4-[(3-methyl-3-sulfobutyl)disulfanyl]butane-2-sulfonic acid.
| Compound Name | 2-methyl-4-[(3-methyl-3-sulfobutyl)disulfanyl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 87519711 |
| Molecular Formula | C10H22O6S4 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-methyl-4-[(3-methyl-3-sulfobutyl)disulfanyl]butane-2-sulfonic acid |
| SMILES | CC(C)(CCSSCCC(C)(C)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C10H22O6S4/c1-9(2,19(11,12)13)5-7-17-18-8-6-10(3,4)20(14,15)16/h5-8H2,1-4H3,(H,11,12,13)(H,14,15,16) |
| InChIKey | DHWBLXZSXUQUCB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|