C18H30O8S4 — CID 10278776
2-methyl-4-[[4-[(3-methyl-3-sulfobutyl)sulfinylmethyl]phenyl]methylsulfinyl]butane-2-sulfonic acid (PubChem CID 10278776) has the molecular formula C18H30O8S4 and a molecular weight of 502.70 g/mol. Its IUPAC name is 2-methyl-4-[[4-[(3-methyl-3-sulfobutyl)sulfinylmethyl]phenyl]methylsulfinyl]butane-2-sulfonic acid.
| Compound Name | 2-methyl-4-[[4-[(3-methyl-3-sulfobutyl)sulfinylmethyl]phenyl]methylsulfinyl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 10278776 |
| Molecular Formula | C18H30O8S4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-methyl-4-[[4-[(3-methyl-3-sulfobutyl)sulfinylmethyl]phenyl]methylsulfinyl]butane-2-sulfonic acid |
| SMILES | CC(C)(CCS(=O)Cc1ccc(CS(=O)CCC(C)(C)S(=O)(=O)O)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C18H30O8S4/c1-17(2,29(21,22)23)9-11-27(19)13-15-5-7-16(8-6-15)14-28(20)12-10-18(3,4)30(24,25)26/h5-8H,9-14H2,1-4H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | WQEJCJLYFKKUBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|