C14H32O7S3 — CID 59037084
2-methyl-6-[5-methyl-5-(trihydroxy-λ4-sulfanyl)hexyl]sulfinylhexane-2-sulfonic acid (PubChem CID 59037084) has the molecular formula C14H32O7S3 and a molecular weight of 408.60 g/mol. Its IUPAC name is 2-methyl-6-[5-methyl-5-(trihydroxy-λ4-sulfanyl)hexyl]sulfinylhexane-2-sulfonic acid.
| Compound Name | 2-methyl-6-[5-methyl-5-(trihydroxy-λ4-sulfanyl)hexyl]sulfinylhexane-2-sulfonic acid |
|---|---|
| PubChem CID | 59037084 |
| Molecular Formula | C14H32O7S3 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-methyl-6-[5-methyl-5-(trihydroxy-λ4-sulfanyl)hexyl]sulfinylhexane-2-sulfonic acid |
| SMILES | CC(C)(CCCCS(=O)CCCCC(C)(C)S(=O)(=O)O)S(O)(O)O |
| InChI | InChI=1S/C14H32O7S3/c1-13(2,23(16,17)18)9-5-7-11-22(15)12-8-6-10-14(3,4)24(19,20)21/h16-18H,5-12H2,1-4H3,(H,19,20,21) |
| InChIKey | YHVDXPBEPLBQAG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|