About 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane
1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane (PubChem CID 147681735) has the molecular formula C18H36F2OS
and a molecular weight of 338.55 g/mol. Its IUPAC name is 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane.
Molecular Properties
| Compound Name | 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane |
| PubChem CID | 147681735 |
| Molecular Formula | C18H36F2OS |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane |
| SMILES | CC(C)(C)CCCCCCCCCS(=O)CCCC(C)(F)F |
| InChI | InChI=1S/C18H36F2OS/c1-17(2,3)13-10-8-6-5-7-9-11-15-22(21)16-12-14-18(4,19)20/h5-16H2,1-4H3 |
| InChIKey | GPGDZCJXKWGNQX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane?
The IUPAC name of 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane (CID 147681735) is 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane.
What is the SMILES notation for 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane?
The canonical SMILES for 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane is CC(C)(C)CCCCCCCCCS(=O)CCCC(C)(F)F.
What is the InChIKey of 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane?
The InChIKey is GPGDZCJXKWGNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36F2OS/c1-17(2,3)13-10-8-6-5-7-9-11-15-22(21)16-12-14-18(4,19)20/h5-16H2,1-4H3.
What are the key properties of 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane?
1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane has a molecular weight of 338.55 g/mol, XLogP of 6.34, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane is sourced from PubChem (CID 147681735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).