C18H36F2OS — CID 147681735
1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane (PubChem CID 147681735) has the molecular formula C18H36F2OS and a molecular weight of 338.55 g/mol. Its IUPAC name is 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane.
| Compound Name | 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane |
|---|---|
| PubChem CID | 147681735 |
| Molecular Formula | C18H36F2OS |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-(4,4-difluoropentylsulfinyl)-10,10-dimethylundecane |
| SMILES | CC(C)(C)CCCCCCCCCS(=O)CCCC(C)(F)F |
| InChI | InChI=1S/C18H36F2OS/c1-17(2,3)13-10-8-6-5-7-9-11-15-22(21)16-12-14-18(4,19)20/h5-16H2,1-4H3 |
| InChIKey | GPGDZCJXKWGNQX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|