C14H22O2S2 — CID 139841346
1,3-bis(propylsulfinylmethyl)benzene (PubChem CID 139841346) has the molecular formula C14H22O2S2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,3-bis(propylsulfinylmethyl)benzene.
| Compound Name | 1,3-bis(propylsulfinylmethyl)benzene |
|---|---|
| PubChem CID | 139841346 |
| Molecular Formula | C14H22O2S2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1,3-bis(propylsulfinylmethyl)benzene |
| SMILES | CCCS(=O)Cc1cccc(CS(=O)CCC)c1 |
| InChI | InChI=1S/C14H22O2S2/c1-3-8-17(15)11-13-6-5-7-14(10-13)12-18(16)9-4-2/h5-7,10H,3-4,8-9,11-12H2,1-2H3 |
| InChIKey | ULSUGWQWZJJEQL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |