C17H38O6S — CID 174807048
3,3-dihydroxy-2-methylbutane-2-sulfonic acid;1-hexoxyhexane (PubChem CID 174807048) has the molecular formula C17H38O6S and a molecular weight of 370.55 g/mol. Its IUPAC name is 3,3-dihydroxy-2-methylbutane-2-sulfonic acid;1-hexoxyhexane.
| Compound Name | 3,3-dihydroxy-2-methylbutane-2-sulfonic acid;1-hexoxyhexane |
|---|---|
| PubChem CID | 174807048 |
| Molecular Formula | C17H38O6S |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3,3-dihydroxy-2-methylbutane-2-sulfonic acid;1-hexoxyhexane |
| SMILES | CC(O)(O)C(C)(C)S(=O)(=O)O.CCCCCCOCCCCCC |
| InChI | InChI=1S/C12H26O.C5H12O5S/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-4(2,5(3,6)7)11(8,9)10/h3-12H2,1-2H3;6-7H,1-3H3,(H,8,9,10) |
| InChIKey | CRWYJJQREMMMBI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|