C10H20N2O4 — CID 160785911
[1-[methoxy(methyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] carbamate (PubChem CID 160785911) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is [1-[methoxy(methyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] carbamate.
| Compound Name | [1-[methoxy(methyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] carbamate |
|---|---|
| PubChem CID | 160785911 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [1-[methoxy(methyl)amino]-4,4-dimethyl-1-oxopentan-2-yl] carbamate |
| SMILES | CON(C)C(=O)C(CC(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C10H20N2O4/c1-10(2,3)6-7(16-9(11)14)8(13)12(4)15-5/h7H,6H2,1-5H3,(H2,11,14) |
| InChIKey | SBEXRCMNAWSFNC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|