C10H19N2O5- — CID 132586846
N-tert-butyl-N-[(2R)-3-hydroxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 132586846) has the molecular formula C10H19N2O5- and a molecular weight of 247.27 g/mol. Its IUPAC name is N-tert-butyl-N-[(2R)-3-hydroxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | N-tert-butyl-N-[(2R)-3-hydroxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 132586846 |
| Molecular Formula | C10H19N2O5- |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-tert-butyl-N-[(2R)-3-hydroxy-1-[methoxy(methyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CON(C)C(=O)[C@@H](CO)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C10H20N2O5/c1-10(2,3)12(9(15)16)7(6-13)8(14)11(4)17-5/h7,13H,6H2,1-5H3,(H,15,16)/p-1/t7-/m1/s1 |
| InChIKey | AIUMJWGQUBNIFV-SSDOTTSWSA-M |
| XLogP | -1.19 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|