C18H35NO2 — CID 126704323
(Z)-N-methoxy-N,2,2,4,7,9,9-heptamethyldec-5-enamide (PubChem CID 126704323) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (Z)-N-methoxy-N,2,2,4,7,9,9-heptamethyldec-5-enamide.
| Compound Name | (Z)-N-methoxy-N,2,2,4,7,9,9-heptamethyldec-5-enamide |
|---|---|
| PubChem CID | 126704323 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (Z)-N-methoxy-N,2,2,4,7,9,9-heptamethyldec-5-enamide |
| SMILES | CON(C)C(=O)C(C)(C)CC(C)/C=C\C(C)CC(C)(C)C |
| InChI | InChI=1S/C18H35NO2/c1-14(12-17(3,4)5)10-11-15(2)13-18(6,7)16(20)19(8)21-9/h10-11,14-15H,12-13H2,1-9H3/b11-10- |
| InChIKey | XHKOMMRQUDQESY-KHPPLWFESA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|