C11H25NO3Si — CID 11207374
(2S)-N-methoxy-N,2,3-trimethyl-2-trimethylsilyloxybutanamide (PubChem CID 11207374) has the molecular formula C11H25NO3Si and a molecular weight of 247.41 g/mol. Its IUPAC name is (2S)-N-methoxy-N,2,3-trimethyl-2-trimethylsilyloxybutanamide.
| Compound Name | (2S)-N-methoxy-N,2,3-trimethyl-2-trimethylsilyloxybutanamide |
|---|---|
| PubChem CID | 11207374 |
| Molecular Formula | C11H25NO3Si |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2S)-N-methoxy-N,2,3-trimethyl-2-trimethylsilyloxybutanamide |
| SMILES | CON(C)C(=O)[C@@](C)(O[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C11H25NO3Si/c1-9(2)11(3,15-16(6,7)8)10(13)12(4)14-5/h9H,1-8H3/t11-/m0/s1 |
| InChIKey | DBDOEYBSIPJLQZ-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|