C14H22N2O3 — CID 129110948
[1-(4-aminophenoxy)-4,4-dimethylpentan-3-yl] carbamate (PubChem CID 129110948) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is [1-(4-aminophenoxy)-4,4-dimethylpentan-3-yl] carbamate.
| Compound Name | [1-(4-aminophenoxy)-4,4-dimethylpentan-3-yl] carbamate |
|---|---|
| PubChem CID | 129110948 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [1-(4-aminophenoxy)-4,4-dimethylpentan-3-yl] carbamate |
| SMILES | CC(C)(C)C(CCOc1ccc(N)cc1)OC(N)=O |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,3)12(19-13(16)17)8-9-18-11-6-4-10(15)5-7-11/h4-7,12H,8-9,15H2,1-3H3,(H2,16,17) |
| InChIKey | BATQOSVEISBTAN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|