C31H50O5Si2 — CID 173273606
bis[4-(3-dimethylsilyloxy-4,4-dimethylpentoxy)phenyl]methanone (PubChem CID 173273606) has the molecular formula C31H50O5Si2 and a molecular weight of 558.91 g/mol. Its IUPAC name is bis[4-(3-dimethylsilyloxy-4,4-dimethylpentoxy)phenyl]methanone.
| Compound Name | bis[4-(3-dimethylsilyloxy-4,4-dimethylpentoxy)phenyl]methanone |
|---|---|
| PubChem CID | 173273606 |
| Molecular Formula | C31H50O5Si2 |
| Molecular Weight | 558.91 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | bis[4-(3-dimethylsilyloxy-4,4-dimethylpentoxy)phenyl]methanone |
| SMILES | C[SiH](C)OC(CCOc1ccc(C(=O)c2ccc(OCCC(O[SiH](C)C)C(C)(C)C)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C31H50O5Si2/c1-30(2,3)27(35-37(7)8)19-21-33-25-15-11-23(12-16-25)29(32)24-13-17-26(18-14-24)34-22-20-28(31(4,5)6)36-38(9)10/h11-18,27-28,37-38H,19-22H2,1-10H3 |
| InChIKey | YPTRUOYDPUIHBU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|