C26H46O3Si — CID 101258878
(2S,5S,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-3-methylidene-1-phenylmethoxynonan-5-ol (PubChem CID 101258878) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is (2S,5S,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-3-methylidene-1-phenylmethoxynonan-5-ol.
| Compound Name | (2S,5S,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-3-methylidene-1-phenylmethoxynonan-5-ol |
|---|---|
| PubChem CID | 101258878 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (2S,5S,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-3-methylidene-1-phenylmethoxynonan-5-ol |
| SMILES | C=C(C[C@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C26H46O3Si/c1-19(2)25(29-30(9,10)26(6,7)8)22(5)24(27)16-20(3)21(4)17-28-18-23-14-12-11-13-15-23/h11-15,19,21-22,24-25,27H,3,16-18H2,1-2,4-10H3/t21-,22+,24+,25+/m1/s1 |
| InChIKey | BEYHXESMLLDJJH-NJRQHTIISA-N |
| XLogP | 6.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|