C23H36O3 — CID 101089779
(4S,5S,6S)-2,2,5-trimethyl-4-(2-methyl-1-phenylmethoxypropan-2-yl)-6-[(2R)-pent-4-en-2-yl]-1,3-dioxane (PubChem CID 101089779) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (4S,5S,6S)-2,2,5-trimethyl-4-(2-methyl-1-phenylmethoxypropan-2-yl)-6-[(2R)-pent-4-en-2-yl]-1,3-dioxane.
| Compound Name | (4S,5S,6S)-2,2,5-trimethyl-4-(2-methyl-1-phenylmethoxypropan-2-yl)-6-[(2R)-pent-4-en-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 101089779 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (4S,5S,6S)-2,2,5-trimethyl-4-(2-methyl-1-phenylmethoxypropan-2-yl)-6-[(2R)-pent-4-en-2-yl]-1,3-dioxane |
| SMILES | C=CC[C@@H](C)[C@@H]1OC(C)(C)O[C@H](C(C)(C)COCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H36O3/c1-8-12-17(2)20-18(3)21(26-23(6,7)25-20)22(4,5)16-24-15-19-13-10-9-11-14-19/h8-11,13-14,17-18,20-21H,1,12,15-16H2,2-7H3/t17-,18+,20+,21+/m1/s1 |
| InChIKey | VADFVIPFPIVRMP-ZFMNYDKASA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|