C19H28O4 — CID 143049599
(2S)-7,7-dimethyl-6-pent-4-en-2-yl-3-phenylmethoxy-1,4-dioxepan-2-ol (PubChem CID 143049599) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (2S)-7,7-dimethyl-6-pent-4-en-2-yl-3-phenylmethoxy-1,4-dioxepan-2-ol.
| Compound Name | (2S)-7,7-dimethyl-6-pent-4-en-2-yl-3-phenylmethoxy-1,4-dioxepan-2-ol |
|---|---|
| PubChem CID | 143049599 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (2S)-7,7-dimethyl-6-pent-4-en-2-yl-3-phenylmethoxy-1,4-dioxepan-2-ol |
| SMILES | C=CCC(C)C1COC(OCc2ccccc2)[C@@H](O)OC1(C)C |
| InChI | InChI=1S/C19H28O4/c1-5-9-14(2)16-13-22-18(17(20)23-19(16,3)4)21-12-15-10-7-6-8-11-15/h5-8,10-11,14,16-18,20H,1,9,12-13H2,2-4H3/t14?,16?,17-,18?/m0/s1 |
| InChIKey | BBIXKTOKAZKLLF-QVNWPQDDSA-N |
| XLogP | 3.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|