C28H47O6PSi — CID 58750452
(4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[2-[(4-methoxyphenyl)methylphosphanyloxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol (PubChem CID 58750452) has the molecular formula C28H47O6PSi and a molecular weight of 538.74 g/mol. Its IUPAC name is (4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[2-[(4-methoxyphenyl)methylphosphanyloxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol.
| Compound Name | (4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[2-[(4-methoxyphenyl)methylphosphanyloxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol |
|---|---|
| PubChem CID | 58750452 |
| Molecular Formula | C28H47O6PSi |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-[2-[(4-methoxyphenyl)methylphosphanyloxy]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-yn-1-ol |
| SMILES | COc1ccc(CPOCC[C@@H]2OC(C)(C)O[C@@H]2C(O)C#C[C@@H](C)C(C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H47O6PSi/c1-20(21(2)34-36(9,10)27(3,4)5)11-16-24(29)26-25(32-28(6,7)33-26)17-18-31-35-19-22-12-14-23(30-8)15-13-22/h12-15,20-21,24-26,29,35H,17-19H2,1-10H3/t20-,21?,24?,25+,26-/m1/s1 |
| InChIKey | MOXVHRZMUVMJSD-STIBMJTPSA-N |
| XLogP | 6.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|