C29H47FO5Si — CID 88956909
tert-butyl-[(E,2S,3R)-6-[(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-5-fluoro-6-[(4-methoxyphenyl)methoxy]-3-methylhex-4-en-2-yl]oxy-dimethylsilane (PubChem CID 88956909) has the molecular formula C29H47FO5Si and a molecular weight of 522.77 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3R)-6-[(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-5-fluoro-6-[(4-methoxyphenyl)methoxy]-3-methylhex-4-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3R)-6-[(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-5-fluoro-6-[(4-methoxyphenyl)methoxy]-3-methylhex-4-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 88956909 |
| Molecular Formula | C29H47FO5Si |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | tert-butyl-[(E,2S,3R)-6-[(4S,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-5-fluoro-6-[(4-methoxyphenyl)methoxy]-3-methylhex-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@@H]1C(OCc1ccc(OC)cc1)/C(F)=C\[C@@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H47FO5Si/c1-12-13-25-27(34-29(7,8)33-25)26(32-19-22-14-16-23(31-9)17-15-22)24(30)18-20(2)21(3)35-36(10,11)28(4,5)6/h12,14-18,20-21,25-27H,1,13,19H2,2-11H3/b24-18+/t20-,21+,25+,26?,27+/m1/s1 |
| InChIKey | DJFJMANXSIFZBI-OAKWNHEGSA-N |
| XLogP | 7.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|