C30H49FO5Si — CID 91532861
[(5S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-[(4-methoxyphenyl)methoxy]-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 91532861) has the molecular formula C30H49FO5Si and a molecular weight of 536.80 g/mol. Its IUPAC name is [(5S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-[(4-methoxyphenyl)methoxy]-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(5S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-[(4-methoxyphenyl)methoxy]-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91532861 |
| Molecular Formula | C30H49FO5Si |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | [(5S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-[(4-methoxyphenyl)methoxy]-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CO[C@@H](C=CCCOC(=O)C(C)(C)C)C(F)=C[C@@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H49FO5Si/c1-22(23(2)36-37(10,11)30(6,7)8)20-26(31)27(14-12-13-19-34-28(32)29(3,4)5)35-21-24-15-17-25(33-9)18-16-24/h12,14-18,20,22-23,27H,13,19,21H2,1-11H3/t22-,23-,27+/m1/s1 |
| InChIKey | SCDCPNKACCFLLV-NOTUOJBMSA-N |
| XLogP | 8.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|