About CID 59466919
CID 59466919 (PubChem CID 59466919) has the molecular formula C35H43BFNO9
and a molecular weight of 651.54 g/mol.
Molecular Properties
| Compound Name | CID 59466919 |
| PubChem CID | 59466919 |
| Molecular Formula | C35H43BFNO9 |
| Molecular Weight | 651.54 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(C)c1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2[C@H](OCc2ccc(OC)cc2)/C(F)=C\[C@@H](C)[C@H](C)O)c2c(c1)OC(C)(C)OC2=O |
| InChI | InChI=1S/C35H43BFNO9/c1-20(21(2)39)16-26(37)30(43-19-22-12-14-25(42-8)15-13-22)31-27(44-34(3,4)46-31)11-9-10-23-17-24(38(7)33(36)41)18-28-29(23)32(40)47-35(5,6)45-28/h9-10,12-18,20-21,27,30-31,39H,11,19H2,1-8H3/b10-9+,26-16+/t20-,21+,27+,30-,31+/m1/s1 |
| InChIKey | DECOAXPSVWKLFQ-VXNPTIJDSA-N |
| XLogP | 6.08 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59466919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59466919?
The IUPAC name of CID 59466919 (CID 59466919) is not available.
What is the SMILES notation for CID 59466919?
The canonical SMILES for CID 59466919 is [B]C(=O)N(C)c1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2[C@H](OCc2ccc(OC)cc2)/C(F)=C\[C@@H](C)[C@H](C)O)c2c(c1)OC(C)(C)OC2=O.
What is the InChIKey of CID 59466919?
The InChIKey is DECOAXPSVWKLFQ-VXNPTIJDSA-N. The full InChI is InChI=1S/C35H43BFNO9/c1-20(21(2)39)16-26(37)30(43-19-22-12-14-25(42-8)15-13-22)31-27(44-34(3,4)46-31)11-9-10-23-17-24(38(7)33(36)41)18-28-29(23)32(40)47-35(5,6)45-28/h9-10,12-18,20-21,27,30-31,39H,11,19H2,1-8H3/b10-9+,26-16+/t20-,21+,27+,30-,31+/m1/s1.
What are the key properties of CID 59466919?
CID 59466919 has a molecular weight of 651.54 g/mol, XLogP of 6.08, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59466919 is sourced from PubChem (CID 59466919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).