C36H45BFNO9 — CID 59466586
CID 59466586 (PubChem CID 59466586) has the molecular formula C36H45BFNO9 and a molecular weight of 665.56 g/mol.
| Compound Name | CID 59466586 |
|---|---|
| PubChem CID | 59466586 |
| Molecular Formula | C36H45BFNO9 |
| Molecular Weight | 665.56 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N(CC)c1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2[C@H](OCc2ccc(OC)cc2)/C(F)=C\[C@@H](C)[C@H](C)O)c2c(c1)OC(C)(C)OC2=O |
| InChI | InChI=1S/C36H45BFNO9/c1-9-39(34(37)42)25-18-24(30-29(19-25)46-36(6,7)48-33(30)41)11-10-12-28-32(47-35(4,5)45-28)31(27(38)17-21(2)22(3)40)44-20-23-13-15-26(43-8)16-14-23/h10-11,13-19,21-22,28,31-32,40H,9,12,20H2,1-8H3/b11-10+,27-17+/t21-,22+,28+,31-,32+/m1/s1 |
| InChIKey | WTNWEJHYGQKBEX-QMONXTJASA-N |
| XLogP | 6.47 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|