C26H40O7Si — CID 122220301
5-[(E)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 122220301) has the molecular formula C26H40O7Si and a molecular weight of 492.69 g/mol. Its IUPAC name is 5-[(E)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 5-[(E)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 122220301 |
| Molecular Formula | C26H40O7Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 5-[(E)-3-[(4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | COc1cc(/C=C/C[C@@H]2OC(C)(C)O[C@@H]2CO[Si](C)(C)C(C)(C)C)c2c(c1)OC(C)(C)OC2=O |
| InChI | InChI=1S/C26H40O7Si/c1-24(2,3)34(9,10)29-16-21-19(30-25(4,5)32-21)13-11-12-17-14-18(28-8)15-20-22(17)23(27)33-26(6,7)31-20/h11-12,14-15,19,21H,13,16H2,1-10H3/b12-11+/t19-,21+/m0/s1 |
| InChIKey | YFOLFHYRKYCTBA-RTIYCVIDSA-N |
| XLogP | 5.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|