C20H30O3 — CID 21160243
(4R,5R)-2,2,5-trimethyl-4-[(E)-6-phenylmethoxyhex-3-enyl]-1,3-dioxane (PubChem CID 21160243) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4R,5R)-2,2,5-trimethyl-4-[(E)-6-phenylmethoxyhex-3-enyl]-1,3-dioxane.
| Compound Name | (4R,5R)-2,2,5-trimethyl-4-[(E)-6-phenylmethoxyhex-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 21160243 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4R,5R)-2,2,5-trimethyl-4-[(E)-6-phenylmethoxyhex-3-enyl]-1,3-dioxane |
| SMILES | C[C@@H]1COC(C)(C)O[C@@H]1CC/C=C/CCOCc1ccccc1 |
| InChI | InChI=1S/C20H30O3/c1-17-15-22-20(2,3)23-19(17)13-9-4-5-10-14-21-16-18-11-7-6-8-12-18/h4-8,11-12,17,19H,9-10,13-16H2,1-3H3/b5-4+/t17-,19-/m1/s1 |
| InChIKey | AACBUJCCYDUUSS-MSIWKICXSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|