C10H18O4 — CID 139076165
(3aS,6S,7S,7aR)-2,2,3a,7-tetramethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol (PubChem CID 139076165) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3aS,6S,7S,7aR)-2,2,3a,7-tetramethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol.
| Compound Name | (3aS,6S,7S,7aR)-2,2,3a,7-tetramethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol |
|---|---|
| PubChem CID | 139076165 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3aS,6S,7S,7aR)-2,2,3a,7-tetramethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-ol |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@@]2(C)CO[C@@H]1O |
| InChI | InChI=1S/C10H18O4/c1-6-7-10(4,5-12-8(6)11)14-9(2,3)13-7/h6-8,11H,5H2,1-4H3/t6-,7+,8-,10-/m0/s1 |
| InChIKey | QQTDXBQRNRMECI-ODHVRURNSA-N |
| XLogP | 0.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |