C12H20O6 — CID 51406942
[(1R,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-2-yl]methanol (PubChem CID 51406942) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(1R,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-2-yl]methanol.
| Compound Name | [(1R,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-2-yl]methanol |
|---|---|
| PubChem CID | 51406942 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(1R,2R,6R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-2-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@H]3OC(C)(C)O[C@@]32CO)O1 |
| InChI | InChI=1S/C12H20O6/c1-10(2)15-7-5-14-9-12(6-13,8(7)16-10)18-11(3,4)17-9/h7-9,13H,5-6H2,1-4H3/t7-,8-,9-,12-/m1/s1 |
| InChIKey | HVDRMLNGZJXRDH-MFYTUXHUSA-N |
| XLogP | 0.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |