C17H28O8 — CID 500372
[2,2-dimethyl-5-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 500372) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is [2,2-dimethyl-5-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2,2-dimethyl-5-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 500372 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [2,2-dimethyl-5-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)OC2COC3(C4OC(C)(C)OC4CO)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C17H28O8/c1-14(2)21-10-8-19-17(12-9(7-18)20-15(3,4)23-12)13(11(10)22-14)24-16(5,6)25-17/h9-13,18H,7-8H2,1-6H3 |
| InChIKey | TYRFSVLXABMDCR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |