C18H32O12 — CID 160933519
(2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol (PubChem CID 160933519) has the molecular formula C18H32O12 and a molecular weight of 440.44 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
|---|---|
| PubChem CID | 160933519 |
| Molecular Formula | C18H32O12 |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(CO)OC(C)(C)O[C@@H]23)O1.OC[C@@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H20O6.C6H12O6/c1-10(2)15-7-5-14-12(6-13)9(8(7)16-10)17-11(3,4)18-12;7-2-6(11)5(10)4(9)3(8)1-12-6/h7-9,13H,5-6H2,1-4H3;3-5,7-11H,1-2H2/t7-,8-,9+,12+;3-,4-,5+,6-/m11/s1 |
| InChIKey | STOOVPQNYZSBCU-HGDWBCKASA-N |
| XLogP | -2.84 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |