C12H20O6 — CID 552052
6-methoxy-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 552052) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 6-methoxy-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 6-methoxy-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 552052 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-methoxy-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | COC12OC3COC(C)(C)OC3C1OC(C)(C)O2 |
| InChI | InChI=1S/C12H20O6/c1-10(2)14-6-7-8(16-10)9-12(13-5,15-7)18-11(3,4)17-9/h7-9H,6H2,1-5H3 |
| InChIKey | AFBDFGLVJYZEQK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |