C9H15BrO2 — CID 11241810
(3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 11241810) has the molecular formula C9H15BrO2 and a molecular weight of 235.12 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 11241810 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2[C@H](CBr)CC[C@@H]2O1 |
| InChI | InChI=1S/C9H15BrO2/c1-9(2)11-7-4-3-6(5-10)8(7)12-9/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChIKey | HNWNOYRPDVIQPG-BIIVOSGPSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|