C11H19BrO3 — CID 10989574
(3aR,9aR)-6-(bromomethyl)-2,2-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-c]oxocine (PubChem CID 10989574) has the molecular formula C11H19BrO3 and a molecular weight of 279.17 g/mol. Its IUPAC name is (3aR,9aR)-6-(bromomethyl)-2,2-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-c]oxocine.
| Compound Name | (3aR,9aR)-6-(bromomethyl)-2,2-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-c]oxocine |
|---|---|
| PubChem CID | 10989574 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (3aR,9aR)-6-(bromomethyl)-2,2-dimethyl-4,6,7,8,9,9a-hexahydro-3aH-[1,3]dioxolo[4,5-c]oxocine |
| SMILES | CC1(C)O[C@@H]2CCCC(CBr)OC[C@H]2O1 |
| InChI | InChI=1S/C11H19BrO3/c1-11(2)14-9-5-3-4-8(6-12)13-7-10(9)15-11/h8-10H,3-7H2,1-2H3/t8?,9-,10-/m1/s1 |
| InChIKey | JPHISVHSENWKRS-VXRWAFEHSA-N |
| XLogP | 2.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|