C10H16O8S — CID 88936698
(1R,2R,7S)-7-methoxy-4,4-dimethyl-3,5,8,11,13-pentaoxa-12λ6-thiatricyclo[7.4.0.02,6]tridecane 12,12-dioxide (PubChem CID 88936698) has the molecular formula C10H16O8S and a molecular weight of 296.30 g/mol. Its IUPAC name is (1R,2R,7S)-7-methoxy-4,4-dimethyl-3,5,8,11,13-pentaoxa-12λ6-thiatricyclo[7.4.0.02,6]tridecane 12,12-dioxide.
| Compound Name | (1R,2R,7S)-7-methoxy-4,4-dimethyl-3,5,8,11,13-pentaoxa-12λ6-thiatricyclo[7.4.0.02,6]tridecane 12,12-dioxide |
|---|---|
| PubChem CID | 88936698 |
| Molecular Formula | C10H16O8S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (1R,2R,7S)-7-methoxy-4,4-dimethyl-3,5,8,11,13-pentaoxa-12λ6-thiatricyclo[7.4.0.02,6]tridecane 12,12-dioxide |
| SMILES | CO[C@H]1OC2COS(=O)(=O)O[C@H]2[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H16O8S/c1-10(2)16-7-6-5(4-14-19(11,12)18-6)15-9(13-3)8(7)17-10/h5-9H,4H2,1-3H3/t5?,6-,7+,8?,9+/m1/s1 |
| InChIKey | MBIDPTZUJXRXFP-IPVXCSAOSA-N |
| XLogP | -0.46 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |