C13H20O8 — CID 11335702
[(3aS,4R,6R,6aS)-6-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 11335702) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-6-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,6R,6aS)-6-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11335702 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [(3aS,4R,6R,6aS)-6-[(4R)-2-methoxy-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | COC1OC[C@H]([C@H]2O[C@H](OC(C)=O)[C@H]3OC(C)(C)O[C@H]32)O1 |
| InChI | InChI=1S/C13H20O8/c1-6(14)17-11-10-9(20-13(2,3)21-10)8(19-11)7-5-16-12(15-4)18-7/h7-12H,5H2,1-4H3/t7-,8-,9+,10+,11+,12?/m1/s1 |
| InChIKey | LPZOLPCFCJVIAI-YELRLYKWSA-N |
| XLogP | 0.14 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |