C12H17NO6S — CID 11278087
[(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-sulfanylidene-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate (PubChem CID 11278087) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-sulfanylidene-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-sulfanylidene-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
|---|---|
| PubChem CID | 11278087 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [(3aS,4R,6R,6aS)-2,2-dimethyl-6-[(4R)-2-sulfanylidene-1,3-oxazolidin-4-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H]([C@H]2COC(=S)N2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C12H17NO6S/c1-5(14)16-10-9-8(18-12(2,3)19-9)7(17-10)6-4-15-11(20)13-6/h6-10H,4H2,1-3H3,(H,13,20)/t6-,7-,8+,9+,10+/m1/s1 |
| InChIKey | UPTHJLCLXZLFNY-ZJDVBMNYSA-N |
| XLogP | 0.07 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|