C11H13NO6 — CID 58843012
(6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) acetate (PubChem CID 58843012) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is (6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) acetate.
| Compound Name | (6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) acetate |
|---|---|
| PubChem CID | 58843012 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) acetate |
| SMILES | COC1C(OC(C)=O)C2OC1C1C(=O)NC(=O)C21 |
| InChI | InChI=1S/C11H13NO6/c1-3(13)17-9-7-5-4(10(14)12-11(5)15)6(18-7)8(9)16-2/h4-9H,1-2H3,(H,12,14,15) |
| InChIKey | MLXOEKPAOSRBBT-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|