C10H16O6 — CID 14865255
[(1R,2R,3S,4R,5R)-3,4-dimethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 14865255) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5R)-3,4-dimethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1R,2R,3S,4R,5R)-3,4-dimethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 14865255 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [(1R,2R,3S,4R,5R)-3,4-dimethoxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H]2OC[C@@H](O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H16O6/c1-5(11)15-7-6-4-14-10(16-6)9(13-3)8(7)12-2/h6-10H,4H2,1-3H3/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | MKXKDFLUWKVUSP-HOTMZDKISA-N |
| XLogP | -0.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |