C22H30O15 — CID 171991255
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(1R,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 171991255) has the molecular formula C22H30O15 and a molecular weight of 534.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(1R,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(1R,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171991255 |
| Molecular Formula | C22H30O15 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[[(1R,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC2[C@H]3CO[C@H](O3)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C22H30O15/c1-8(23)29-6-13-15(28)17(31-9(2)24)19(33-11(4)26)22(35-13)37-16-14-7-30-21(36-14)20(34-12(5)27)18(16)32-10(3)25/h13-22,28H,6-7H2,1-5H3/t13-,14-,15-,16?,17+,18+,19-,20-,21-,22+/m1/s1 |
| InChIKey | SYWLDUVYMYIDKQ-KKVBSMGHSA-N |
| XLogP | -1.50 |
| TPSA | 188.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|