C13H18O4 — CID 10561899
[(1R,2R,3R,6S,7S,8S,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridecan-8-yl] acetate (PubChem CID 10561899) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is [(1R,2R,3R,6S,7S,8S,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridecan-8-yl] acetate.
| Compound Name | [(1R,2R,3R,6S,7S,8S,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridecan-8-yl] acetate |
|---|---|
| PubChem CID | 10561899 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [(1R,2R,3R,6S,7S,8S,9R)-11,12-dioxatetracyclo[7.2.1.13,6.02,7]tridecan-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@H]3CC[C@H](C3)[C@H]2[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C13H18O4/c1-6(14)16-12-9-5-15-13(17-9)11-8-3-2-7(4-8)10(11)12/h7-13H,2-5H2,1H3/t7-,8+,9+,10-,11+,12+,13+/m0/s1 |
| InChIKey | CJYCLVOSXYGEKS-UWHNJUSGSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |