C16H20O9 — CID 10641970
[(1R,2S,3S,5S,6R,7S,8S,9R)-6,8-diacetyloxy-4,11,12-trioxatetracyclo[7.2.1.02,7.03,5]dodecan-3-yl]methyl acetate (PubChem CID 10641970) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is [(1R,2S,3S,5S,6R,7S,8S,9R)-6,8-diacetyloxy-4,11,12-trioxatetracyclo[7.2.1.02,7.03,5]dodecan-3-yl]methyl acetate.
| Compound Name | [(1R,2S,3S,5S,6R,7S,8S,9R)-6,8-diacetyloxy-4,11,12-trioxatetracyclo[7.2.1.02,7.03,5]dodecan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10641970 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(1R,2S,3S,5S,6R,7S,8S,9R)-6,8-diacetyloxy-4,11,12-trioxatetracyclo[7.2.1.02,7.03,5]dodecan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12O[C@H]1[C@H](OC(C)=O)[C@@H]1[C@H](OC(C)=O)[C@H]3CO[C@H](O3)[C@@H]12 |
| InChI | InChI=1S/C16H20O9/c1-6(17)21-5-16-11-10(13(14(16)25-16)23-8(3)19)12(22-7(2)18)9-4-20-15(11)24-9/h9-15H,4-5H2,1-3H3/t9-,10+,11-,12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | HZPUQYKLABRBKD-NZZARTGWSA-N |
| XLogP | -0.45 |
| TPSA | 109.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|