C15H22O8 — CID 14158143
[(3aR,4R,5S,6R,7aS)-4,5-diacetyloxy-3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-6-yl]methyl acetate (PubChem CID 14158143) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is [(3aR,4R,5S,6R,7aS)-4,5-diacetyloxy-3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-6-yl]methyl acetate.
| Compound Name | [(3aR,4R,5S,6R,7aS)-4,5-diacetyloxy-3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 14158143 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(3aR,4R,5S,6R,7aS)-4,5-diacetyloxy-3-methyl-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2OCC(C)[C@@H]2[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O8/c1-7-5-20-15-12(7)14(22-10(4)18)13(21-9(3)17)11(23-15)6-19-8(2)16/h7,11-15H,5-6H2,1-4H3/t7?,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | YECBGCAEWNZZIG-VVKIIABCSA-N |
| XLogP | 0.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|