C14H18O5 — CID 10491968
[(1R,3S,4R,6R,7R,8S,10R,11R)-6-acetyloxy-9-oxatetracyclo[5.3.1.04,11.08,10]undecan-3-yl] acetate (PubChem CID 10491968) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(1R,3S,4R,6R,7R,8S,10R,11R)-6-acetyloxy-9-oxatetracyclo[5.3.1.04,11.08,10]undecan-3-yl] acetate.
| Compound Name | [(1R,3S,4R,6R,7R,8S,10R,11R)-6-acetyloxy-9-oxatetracyclo[5.3.1.04,11.08,10]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 10491968 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(1R,3S,4R,6R,7R,8S,10R,11R)-6-acetyloxy-9-oxatetracyclo[5.3.1.04,11.08,10]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@H]3O[C@H]3[C@@H]3[C@@H]2[C@H]1C[C@H]3OC(C)=O |
| InChI | InChI=1S/C14H18O5/c1-5(15)17-9-4-8-11-7(9)3-10(18-6(2)16)12(11)14-13(8)19-14/h7-14H,3-4H2,1-2H3/t7-,8+,9-,10+,11+,12-,13+,14-/m0/s1 |
| InChIKey | DPJXYXNTLXTGNU-GHKKJFFVSA-N |
| XLogP | 0.90 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|