C34H34O5S3 — CID 91079536
1-[(3aR,5R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-tris(phenylsulfanyl)ethanol (PubChem CID 91079536) has the molecular formula C34H34O5S3 and a molecular weight of 618.84 g/mol. Its IUPAC name is 1-[(3aR,5R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-tris(phenylsulfanyl)ethanol.
| Compound Name | 1-[(3aR,5R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-tris(phenylsulfanyl)ethanol |
|---|---|
| PubChem CID | 91079536 |
| Molecular Formula | C34H34O5S3 |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 1-[(3aR,5R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,2-tris(phenylsulfanyl)ethanol |
| SMILES | CC1(C)O[C@H]2O[C@H](C(O)C(Sc3ccccc3)(Sc3ccccc3)Sc3ccccc3)C(OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C34H34O5S3/c1-33(2)38-30-28(36-23-24-15-7-3-8-16-24)29(37-32(30)39-33)31(35)34(40-25-17-9-4-10-18-25,41-26-19-11-5-12-20-26)42-27-21-13-6-14-22-27/h3-22,28-32,35H,23H2,1-2H3/t28?,29-,30-,31?,32+/m0/s1 |
| InChIKey | IDLSGTFCLXIAIA-ZYZOFLKDSA-N |
| XLogP | 7.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|