C48H52FeO4P2 — CID 134932181
CID 134932181 (PubChem CID 134932181) has the molecular formula C48H52FeO4P2 and a molecular weight of 810.73 g/mol.
| Compound Name | CID 134932181 |
|---|---|
| PubChem CID | 134932181 |
| Molecular Formula | C48H52FeO4P2 |
| Molecular Weight | 810.73 g/mol |
| Exact Mass | 810.27 |
| IUPAC Name | — |
| SMILES | CC1(C)O[C@@H](C[C]2[CH][CH][CH][CH]2)[C@H](CP(c2ccccc2)c2ccccc2)O1.CC1(C)O[C@@H](C[C]2[CH][CH][CH][CH]2)[C@H](CP(c2ccccc2)c2ccccc2)O1.[Fe] |
| InChI | InChI=1S/2C24H26O2P.Fe/c2*1-24(2)25-22(17-19-11-9-10-12-19)23(26-24)18-27(20-13-5-3-6-14-20)21-15-7-4-8-16-21;/h2*3-16,22-23H,17-18H2,1-2H3;/t2*22-,23-;/m00./s1 |
| InChIKey | GQNBYMXVMNOLAZ-FKIONSPYSA-N |
| XLogP | 8.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.73 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|