C28H42O4Si — CID 67932829
(1'S,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-phenylbut-1-ynyl]-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67932829) has the molecular formula C28H42O4Si and a molecular weight of 470.73 g/mol. Its IUPAC name is (1'S,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-phenylbut-1-ynyl]-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-phenylbut-1-ynyl]-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67932829 |
| Molecular Formula | C28H42O4Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (1'S,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4-phenylbut-1-ynyl]-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CC1[C@@H]2[C@@H](C#C[C@@](C)(Cc3ccccc3)O[Si](C)(C)C(C)(C)C)[C@H](O)CC[C@@H]2C12OCCO2 |
| InChI | InChI=1S/C28H42O4Si/c1-20-25-22(24(29)14-13-23(25)28(20)30-17-18-31-28)15-16-27(5,19-21-11-9-8-10-12-21)32-33(6,7)26(2,3)4/h8-12,20,22-25,29H,13-14,17-19H2,1-7H3/t20?,22-,23-,24+,25+,27-/m0/s1 |
| InChIKey | HWANHUJOMBZPIY-NWOHGOIWSA-N |
| XLogP | 5.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|