C23H32O5 — CID 57184590
4-[(1R,2R,3R,6S)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 57184590) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is 4-[(1R,2R,3R,6S)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1R,2R,3R,6S)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 57184590 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 4-[(1R,2R,3R,6S)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | C[C@]12CC[C@@H](O)[C@H](CCC(O)COc3ccccc3)[C@H]1CC2=CCCC(=O)O |
| InChI | InChI=1S/C23H32O5/c1-23-13-12-21(25)19(20(23)14-16(23)6-5-9-22(26)27)11-10-17(24)15-28-18-7-3-2-4-8-18/h2-4,6-8,17,19-21,24-25H,5,9-15H2,1H3,(H,26,27)/t17?,19-,20-,21-,23-/m1/s1 |
| InChIKey | ARNMZFDHBHTHDX-YCYAPWRFSA-N |
| XLogP | 3.79 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|