C26H38O6 — CID 70425549
6-[(1R,2R,3R,6R)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]hexanoic acid (PubChem CID 70425549) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 6-[(1R,2R,3R,6R)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]hexanoic acid.
| Compound Name | 6-[(1R,2R,3R,6R)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]hexanoic acid |
|---|---|
| PubChem CID | 70425549 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 6-[(1R,2R,3R,6R)-3-hydroxy-2-(3-hydroxy-4-phenoxybutyl)-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]hexanoic acid |
| SMILES | CO[C@]12CC[C@@H](O)[C@H](CCC(O)COc3ccccc3)[C@H]1C(C)C2=CCCCCC(=O)O |
| InChI | InChI=1S/C26H38O6/c1-18-22(11-7-4-8-12-24(29)30)26(31-2)16-15-23(28)21(25(18)26)14-13-19(27)17-32-20-9-5-3-6-10-20/h3,5-6,9-11,18-19,21,23,25,27-28H,4,7-8,12-17H2,1-2H3,(H,29,30)/t18?,19?,21-,23+,25+,26-/m0/s1 |
| InChIKey | QDZNBGYGNJYYGH-AUXYHODFSA-N |
| XLogP | 4.20 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|