C23H38O3 — CID 57042761
(1S,2S,3S,6R)-2-[(3R)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6-hexyl-3-hydroxybicyclo[4.2.0]octan-7-one (PubChem CID 57042761) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (1S,2S,3S,6R)-2-[(3R)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6-hexyl-3-hydroxybicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2S,3S,6R)-2-[(3R)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6-hexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 57042761 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (1S,2S,3S,6R)-2-[(3R)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6-hexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
| SMILES | CCCCCC[C@@]12CC[C@H](O)[C@@H](C=C[C@H](O)C3CCCCC3)[C@@H]1CC2=O |
| InChI | InChI=1S/C23H38O3/c1-2-3-4-8-14-23-15-13-21(25)18(19(23)16-22(23)26)11-12-20(24)17-9-6-5-7-10-17/h11-12,17-21,24-25H,2-10,13-16H2,1H3/t18-,19-,20-,21-,23+/m0/s1 |
| InChIKey | FEVPFARVWQUNNQ-DDTUGOMQSA-N |
| XLogP | 4.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|