C25H42O4 — CID 67929598
(1'S,2'R,3'R,6'S)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethyl-8'-(2-methylpropyl)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 67929598) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (1'S,2'R,3'R,6'S)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethyl-8'-(2-methylpropyl)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'R,3'R,6'S)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethyl-8'-(2-methylpropyl)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 67929598 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (1'S,2'R,3'R,6'S)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethyl-8'-(2-methylpropyl)spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CC[C@]12CC[C@@H](O)[C@H](/C=C/[C@@H](O)C3CCCCC3)[C@H]1C(CC(C)C)C21OCCO1 |
| InChI | InChI=1S/C25H42O4/c1-4-24-13-12-22(27)19(10-11-21(26)18-8-6-5-7-9-18)23(24)20(16-17(2)3)25(24)28-14-15-29-25/h10-11,17-23,26-27H,4-9,12-16H2,1-3H3/b11-10+/t19-,20?,21+,22+,23-,24-/m0/s1 |
| InChIKey | TZXIFRWVJVQMDA-GGHZBXKOSA-N |
| XLogP | 4.69 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|