C24H33ClO5 — CID 91516853
7-[2-[5-(2-chlorophenyl)-3-(hydroxymethyl)pent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 91516853) has the molecular formula C24H33ClO5 and a molecular weight of 436.98 g/mol. Its IUPAC name is 7-[2-[5-(2-chlorophenyl)-3-(hydroxymethyl)pent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[2-[5-(2-chlorophenyl)-3-(hydroxymethyl)pent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 91516853 |
| Molecular Formula | C24H33ClO5 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 7-[2-[5-(2-chlorophenyl)-3-(hydroxymethyl)pent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(O)CC(O)C1CCC(C#Cc1ccccc1Cl)CO |
| InChI | InChI=1S/C24H33ClO5/c25-21-9-6-5-7-18(21)13-11-17(16-26)12-14-20-19(22(27)15-23(20)28)8-3-1-2-4-10-24(29)30/h5-7,9,17,19-20,22-23,26-28H,1-4,8,10,12,14-16H2,(H,29,30) |
| InChIKey | PSHOZMJWXYFLOS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|